C31H31N7O2S — CID 66877405
1-[3-[(1-benzylindazol-5-yl)amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-morpholin-4-ylbut-2-en-1-one (PubChem CID 66877405) has the molecular formula C31H31N7O2S and a molecular weight of 565.70 g/mol. Its IUPAC name is 1-[3-[(1-benzylindazol-5-yl)amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-morpholin-4-ylbut-2-en-1-one.
| Compound Name | 1-[3-[(1-benzylindazol-5-yl)amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-morpholin-4-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 66877405 |
| Molecular Formula | C31H31N7O2S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | 1-[3-[(1-benzylindazol-5-yl)amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-morpholin-4-ylbut-2-en-1-one |
| SMILES | O=C(C=CCN1CCOCC1)N1CCc2c(sc3ncnc(Nc4ccc5c(cnn5Cc5ccccc5)c4)c23)C1 |
| InChI | InChI=1S/C31H31N7O2S/c39-28(7-4-11-36-13-15-40-16-14-36)37-12-10-25-27(20-37)41-31-29(25)30(32-21-33-31)35-24-8-9-26-23(17-24)18-34-38(26)19-22-5-2-1-3-6-22/h1-9,17-18,21H,10-16,19-20H2,(H,32,33,35) |
| InChIKey | ZMPNJOYRMUQSPI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|