C33H34N6OS — CID 66877429
1-[3-[(1-benzylindol-5-yl)amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-piperidin-1-ylbut-2-en-1-one (PubChem CID 66877429) has the molecular formula C33H34N6OS and a molecular weight of 562.74 g/mol. Its IUPAC name is 1-[3-[(1-benzylindol-5-yl)amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-piperidin-1-ylbut-2-en-1-one.
| Compound Name | 1-[3-[(1-benzylindol-5-yl)amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-piperidin-1-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 66877429 |
| Molecular Formula | C33H34N6OS |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | 1-[3-[(1-benzylindol-5-yl)amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-piperidin-1-ylbut-2-en-1-one |
| SMILES | O=C(C=CCN1CCCCC1)N1CCc2c(sc3ncnc(Nc4ccc5c(ccn5Cc5ccccc5)c4)c23)C1 |
| InChI | InChI=1S/C33H34N6OS/c40-30(10-7-17-37-15-5-2-6-16-37)39-19-14-27-29(22-39)41-33-31(27)32(34-23-35-33)36-26-11-12-28-25(20-26)13-18-38(28)21-24-8-3-1-4-9-24/h1,3-4,7-13,18,20,23H,2,5-6,14-17,19,21-22H2,(H,34,35,36) |
| InChIKey | ZLRQNQFDHSHVMZ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|