C31H31ClFN5O2S — CID 66877648
1-[3-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-piperidin-1-ylbut-2-en-1-one (PubChem CID 66877648) has the molecular formula C31H31ClFN5O2S and a molecular weight of 592.14 g/mol. Its IUPAC name is 1-[3-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-piperidin-1-ylbut-2-en-1-one.
| Compound Name | 1-[3-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-piperidin-1-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 66877648 |
| Molecular Formula | C31H31ClFN5O2S |
| Molecular Weight | 592.14 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | 1-[3-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-piperidin-1-ylbut-2-en-1-one |
| SMILES | O=C(C=CCN1CCCCC1)N1CCc2c(sc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C31H31ClFN5O2S/c32-25-17-23(9-10-26(25)40-19-21-6-4-7-22(33)16-21)36-30-29-24-11-15-38(18-27(24)41-31(29)35-20-34-30)28(39)8-5-14-37-12-2-1-3-13-37/h4-10,16-17,20H,1-3,11-15,18-19H2,(H,34,35,36) |
| InChIKey | PGYHLGJCLUWKFV-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.14 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|