C30H31ClN6O2S — CID 59586989
(E)-1-[3-[3-chloro-4-(pyridin-3-ylmethoxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-5-pyrrolidin-1-ylpent-2-en-1-one (PubChem CID 59586989) has the molecular formula C30H31ClN6O2S and a molecular weight of 575.14 g/mol. Its IUPAC name is (E)-1-[3-[3-chloro-4-(pyridin-3-ylmethoxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-5-pyrrolidin-1-ylpent-2-en-1-one.
| Compound Name | (E)-1-[3-[3-chloro-4-(pyridin-3-ylmethoxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-5-pyrrolidin-1-ylpent-2-en-1-one |
|---|---|
| PubChem CID | 59586989 |
| Molecular Formula | C30H31ClN6O2S |
| Molecular Weight | 575.14 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | (E)-1-[3-[3-chloro-4-(pyridin-3-ylmethoxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-5-pyrrolidin-1-ylpent-2-en-1-one |
| SMILES | O=C(/C=C/CCN1CCCC1)N1CCc2c(sc3ncnc(Nc4ccc(OCc5cccnc5)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C30H31ClN6O2S/c31-24-16-22(8-9-25(24)39-19-21-6-5-11-32-17-21)35-29-28-23-10-15-37(18-26(23)40-30(28)34-20-33-29)27(38)7-1-2-12-36-13-3-4-14-36/h1,5-9,11,16-17,20H,2-4,10,12-15,18-19H2,(H,33,34,35)/b7-1+ |
| InChIKey | WAJVVIWVHAQSLC-LREOWRDNSA-N |
| XLogP | 5.99 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.14 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|