C28H24ClN7O2S — CID 66877701
1-[3-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-imidazol-1-ylbut-2-en-1-one (PubChem CID 66877701) has the molecular formula C28H24ClN7O2S and a molecular weight of 558.07 g/mol. Its IUPAC name is 1-[3-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-imidazol-1-ylbut-2-en-1-one.
| Compound Name | 1-[3-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-imidazol-1-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 66877701 |
| Molecular Formula | C28H24ClN7O2S |
| Molecular Weight | 558.07 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | 1-[3-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-imidazol-1-ylbut-2-en-1-one |
| SMILES | O=C(C=CCn1ccnc1)N1CCc2c(sc3ncnc(Nc4ccc(OCc5ccccn5)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C28H24ClN7O2S/c29-22-14-19(6-7-23(22)38-16-20-4-1-2-9-31-20)34-27-26-21-8-12-36(15-24(21)39-28(26)33-17-32-27)25(37)5-3-11-35-13-10-30-18-35/h1-7,9-10,13-14,17-18H,8,11-12,15-16H2,(H,32,33,34) |
| InChIKey | KZEFBPMZZQUZLU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.07 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|