C30H33ClN6O2S — CID 59586955
(E)-1-[3-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[ethyl(propan-2-yl)amino]but-2-en-1-one (PubChem CID 59586955) has the molecular formula C30H33ClN6O2S and a molecular weight of 577.15 g/mol. Its IUPAC name is (E)-1-[3-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[ethyl(propan-2-yl)amino]but-2-en-1-one.
| Compound Name | (E)-1-[3-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[ethyl(propan-2-yl)amino]but-2-en-1-one |
|---|---|
| PubChem CID | 59586955 |
| Molecular Formula | C30H33ClN6O2S |
| Molecular Weight | 577.15 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | (E)-1-[3-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[ethyl(propan-2-yl)amino]but-2-en-1-one |
| SMILES | CCN(C/C=C/C(=O)N1CCc2c(sc3ncnc(Nc4ccc(OCc5ccccn5)c(Cl)c4)c23)C1)C(C)C |
| InChI | InChI=1S/C30H33ClN6O2S/c1-4-36(20(2)3)14-7-9-27(38)37-15-12-23-26(17-37)40-30-28(23)29(33-19-34-30)35-21-10-11-25(24(31)16-21)39-18-22-8-5-6-13-32-22/h5-11,13,16,19-20H,4,12,14-15,17-18H2,1-3H3,(H,33,34,35)/b9-7+ |
| InChIKey | OKUKIYUBWHQUQU-VQHVLOKHSA-N |
| XLogP | 6.23 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.15 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|