C23H25Cl2N5OS — CID 58116894
(E)-1-[3-(3,4-dichloroanilino)-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-12-yl]-4-[methyl(propan-2-yl)amino]but-2-en-1-one (PubChem CID 58116894) has the molecular formula C23H25Cl2N5OS and a molecular weight of 490.46 g/mol. Its IUPAC name is (E)-1-[3-(3,4-dichloroanilino)-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-12-yl]-4-[methyl(propan-2-yl)amino]but-2-en-1-one.
| Compound Name | (E)-1-[3-(3,4-dichloroanilino)-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-12-yl]-4-[methyl(propan-2-yl)amino]but-2-en-1-one |
|---|---|
| PubChem CID | 58116894 |
| Molecular Formula | C23H25Cl2N5OS |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | (E)-1-[3-(3,4-dichloroanilino)-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-12-yl]-4-[methyl(propan-2-yl)amino]but-2-en-1-one |
| SMILES | CC(C)N(C)C/C=C/C(=O)N1CCc2sc3ncnc(Nc4ccc(Cl)c(Cl)c4)c3c2C1 |
| InChI | InChI=1S/C23H25Cl2N5OS/c1-14(2)29(3)9-4-5-20(31)30-10-8-19-16(12-30)21-22(26-13-27-23(21)32-19)28-15-6-7-17(24)18(25)11-15/h4-7,11,13-14H,8-10,12H2,1-3H3,(H,26,27,28)/b5-4+ |
| InChIKey | LUAGTXJZTHBNFU-SNAWJCMRSA-N |
| XLogP | 5.52 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|