C23H25Cl2N5OS — CID 68716400
(E)-1-[3-(3,4-dichloroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(2-methylpropylamino)but-2-en-1-one (PubChem CID 68716400) has the molecular formula C23H25Cl2N5OS and a molecular weight of 490.46 g/mol. Its IUPAC name is (E)-1-[3-(3,4-dichloroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(2-methylpropylamino)but-2-en-1-one.
| Compound Name | (E)-1-[3-(3,4-dichloroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(2-methylpropylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 68716400 |
| Molecular Formula | C23H25Cl2N5OS |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | (E)-1-[3-(3,4-dichloroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(2-methylpropylamino)but-2-en-1-one |
| SMILES | CC(C)CNC/C=C/C(=O)N1CCc2c(sc3ncnc(Nc4ccc(Cl)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C23H25Cl2N5OS/c1-14(2)11-26-8-3-4-20(31)30-9-7-16-19(12-30)32-23-21(16)22(27-13-28-23)29-15-5-6-17(24)18(25)10-15/h3-6,10,13-14,26H,7-9,11-12H2,1-2H3,(H,27,28,29)/b4-3+ |
| InChIKey | GXHLVUUCXNUCMM-ONEGZZNKSA-N |
| XLogP | 5.43 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|