C28H34Cl2N6O2S — CID 70915435
4-[[(E)-4-[3-(3,4-dichloroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]-propylamino]-N,N-dimethylbutanamide (PubChem CID 70915435) has the molecular formula C28H34Cl2N6O2S and a molecular weight of 589.59 g/mol. Its IUPAC name is 4-[[(E)-4-[3-(3,4-dichloroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]-propylamino]-N,N-dimethylbutanamide.
| Compound Name | 4-[[(E)-4-[3-(3,4-dichloroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]-propylamino]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 70915435 |
| Molecular Formula | C28H34Cl2N6O2S |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | 4-[[(E)-4-[3-(3,4-dichloroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]-propylamino]-N,N-dimethylbutanamide |
| SMILES | CCCN(C/C=C/C(=O)N1CCc2c(sc3ncnc(Nc4ccc(Cl)c(Cl)c4)c23)C1)CCCC(=O)N(C)C |
| InChI | InChI=1S/C28H34Cl2N6O2S/c1-4-12-35(13-5-7-24(37)34(2)3)14-6-8-25(38)36-15-11-20-23(17-36)39-28-26(20)27(31-18-32-28)33-19-9-10-21(29)22(30)16-19/h6,8-10,16,18H,4-5,7,11-15,17H2,1-3H3,(H,31,32,33)/b8-6+ |
| InChIKey | ZWKOZUZVAZYUNK-SOFGYWHQSA-N |
| XLogP | 5.76 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|