C27H31ClFN5O3S — CID 123877298
1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[2-methoxyethyl(oxolan-2-ylmethyl)amino]but-2-en-1-one (PubChem CID 123877298) has the molecular formula C27H31ClFN5O3S and a molecular weight of 560.10 g/mol. Its IUPAC name is 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[2-methoxyethyl(oxolan-2-ylmethyl)amino]but-2-en-1-one.
| Compound Name | 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[2-methoxyethyl(oxolan-2-ylmethyl)amino]but-2-en-1-one |
|---|---|
| PubChem CID | 123877298 |
| Molecular Formula | C27H31ClFN5O3S |
| Molecular Weight | 560.10 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[2-methoxyethyl(oxolan-2-ylmethyl)amino]but-2-en-1-one |
| SMILES | COCCN(CC=CC(=O)N1CCc2c(sc3ncnc(Nc4ccc(F)c(Cl)c4)c23)C1)CC1CCCO1 |
| InChI | InChI=1S/C27H31ClFN5O3S/c1-36-13-11-33(15-19-4-3-12-37-19)9-2-5-24(35)34-10-8-20-23(16-34)38-27-25(20)26(30-17-31-27)32-18-6-7-22(29)21(28)14-18/h2,5-7,14,17,19H,3-4,8-13,15-16H2,1H3,(H,30,31,32) |
| InChIKey | BDFXFWSMLNIUKL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.10 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|