C17H21N5O2S — CID 143991568
(E)-1-(3-amino-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-4-morpholin-4-ylbut-2-en-1-one (PubChem CID 143991568) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is (E)-1-(3-amino-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-4-morpholin-4-ylbut-2-en-1-one.
| Compound Name | (E)-1-(3-amino-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-4-morpholin-4-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 143991568 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (E)-1-(3-amino-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-4-morpholin-4-ylbut-2-en-1-one |
| SMILES | Nc1ncnc2sc3c(c12)CCN(C(=O)/C=C/CN1CCOCC1)C3 |
| InChI | InChI=1S/C17H21N5O2S/c18-16-15-12-3-5-22(10-13(12)25-17(15)20-11-19-16)14(23)2-1-4-21-6-8-24-9-7-21/h1-2,11H,3-10H2,(H2,18,19,20)/b2-1+ |
| InChIKey | BPQFRLXQRVMCDA-OWOJBTEDSA-N |
| XLogP | 1.05 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|