C15H19ClN2O2S — CID 156810600
(E)-1-(2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)-4-morpholin-4-ylbut-2-en-1-one (PubChem CID 156810600) has the molecular formula C15H19ClN2O2S and a molecular weight of 326.85 g/mol. Its IUPAC name is (E)-1-(2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)-4-morpholin-4-ylbut-2-en-1-one.
| Compound Name | (E)-1-(2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)-4-morpholin-4-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 156810600 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (E)-1-(2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)-4-morpholin-4-ylbut-2-en-1-one |
| SMILES | O=C(/C=C/CN1CCOCC1)N1CCc2cc(Cl)sc2C1 |
| InChI | InChI=1S/C15H19ClN2O2S/c16-14-10-12-3-5-18(11-13(12)21-14)15(19)2-1-4-17-6-8-20-9-7-17/h1-2,10H,3-9,11H2/b2-1+ |
| InChIKey | FIWXXTXPUBXQHV-OWOJBTEDSA-N |
| XLogP | 2.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|