C21H19ClF3N3O4S — CID 156810405
1-(2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)prop-2-en-1-one;[4-phenyl-3-(trifluoromethyl)pyrazol-1-yl]methanetriol (PubChem CID 156810405) has the molecular formula C21H19ClF3N3O4S and a molecular weight of 501.91 g/mol. Its IUPAC name is 1-(2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)prop-2-en-1-one;[4-phenyl-3-(trifluoromethyl)pyrazol-1-yl]methanetriol.
| Compound Name | 1-(2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)prop-2-en-1-one;[4-phenyl-3-(trifluoromethyl)pyrazol-1-yl]methanetriol |
|---|---|
| PubChem CID | 156810405 |
| Molecular Formula | C21H19ClF3N3O4S |
| Molecular Weight | 501.91 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 1-(2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)prop-2-en-1-one;[4-phenyl-3-(trifluoromethyl)pyrazol-1-yl]methanetriol |
| SMILES | C=CC(=O)N1CCc2cc(Cl)sc2C1.OC(O)(O)n1cc(-c2ccccc2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H9F3N2O3.C10H10ClNOS/c12-10(13,14)9-8(7-4-2-1-3-5-7)6-16(15-9)11(17,18)19;1-2-10(13)12-4-3-7-5-9(11)14-8(7)6-12/h1-6,17-19H;2,5H,1,3-4,6H2 |
| InChIKey | AKGQHZUIUHUBCM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.91 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|