C19H15ClN2O2S — CID 156810294
1-[(4S)-2-chloro-4-[2-(1,2-oxazol-4-yl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one (PubChem CID 156810294) has the molecular formula C19H15ClN2O2S and a molecular weight of 370.86 g/mol. Its IUPAC name is 1-[(4S)-2-chloro-4-[2-(1,2-oxazol-4-yl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one.
| Compound Name | 1-[(4S)-2-chloro-4-[2-(1,2-oxazol-4-yl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156810294 |
| Molecular Formula | C19H15ClN2O2S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 1-[(4S)-2-chloro-4-[2-(1,2-oxazol-4-yl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1Cc2sc(Cl)cc2[C@H](c2ccccc2-c2cnoc2)C1 |
| InChI | InChI=1S/C19H15ClN2O2S/c1-2-19(23)22-9-16(15-7-18(20)25-17(15)10-22)14-6-4-3-5-13(14)12-8-21-24-11-12/h2-8,11,16H,1,9-10H2/t16-/m0/s1 |
| InChIKey | VKAAOOWBJSVLCG-INIZCTEOSA-N |
| XLogP | 4.72 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|