C21H16ClFN2OS — CID 156810220
1-[(4R)-2-chloro-4-[2-(6-fluoro-3-pyridinyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one (PubChem CID 156810220) has the molecular formula C21H16ClFN2OS and a molecular weight of 398.89 g/mol. Its IUPAC name is 1-[(4R)-2-chloro-4-[2-(6-fluoro-3-pyridinyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one.
| Compound Name | 1-[(4R)-2-chloro-4-[2-(6-fluoro-3-pyridinyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156810220 |
| Molecular Formula | C21H16ClFN2OS |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 1-[(4R)-2-chloro-4-[2-(6-fluoro-3-pyridinyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1Cc2sc(Cl)cc2[C@@H](c2ccccc2-c2ccc(F)nc2)C1 |
| InChI | InChI=1S/C21H16ClFN2OS/c1-2-21(26)25-11-17(16-9-19(22)27-18(16)12-25)15-6-4-3-5-14(15)13-7-8-20(23)24-10-13/h2-10,17H,1,11-12H2/t17-/m1/s1 |
| InChIKey | AAYXZEMXSMBSBB-QGZVFWFLSA-N |
| XLogP | 5.26 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|