C26H23F3N2O — CID 170736109
1-[6-(benzylamino)-7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one (PubChem CID 170736109) has the molecular formula C26H23F3N2O and a molecular weight of 436.48 g/mol. Its IUPAC name is 1-[6-(benzylamino)-7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one.
| Compound Name | 1-[6-(benzylamino)-7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170736109 |
| Molecular Formula | C26H23F3N2O |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 1-[6-(benzylamino)-7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2cc(NCc3ccccc3)c(-c3ccc(C(F)(F)F)cc3)cc2C1 |
| InChI | InChI=1S/C26H23F3N2O/c1-2-25(32)31-13-12-20-15-24(30-16-18-6-4-3-5-7-18)23(14-21(20)17-31)19-8-10-22(11-9-19)26(27,28)29/h2-11,14-15,30H,1,12-13,16-17H2 |
| InChIKey | WMJXNLLLSKHBIK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|