C21H23F3N2 — CID 174176238
N,N-dimethyl-2-prop-2-enyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-6-amine (PubChem CID 174176238) has the molecular formula C21H23F3N2 and a molecular weight of 360.42 g/mol. Its IUPAC name is N,N-dimethyl-2-prop-2-enyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-6-amine.
| Compound Name | N,N-dimethyl-2-prop-2-enyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-6-amine |
|---|---|
| PubChem CID | 174176238 |
| Molecular Formula | C21H23F3N2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N,N-dimethyl-2-prop-2-enyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-6-amine |
| SMILES | C=CCN1CCc2cc(N(C)C)c(-c3ccc(C(F)(F)F)cc3)cc2C1 |
| InChI | InChI=1S/C21H23F3N2/c1-4-10-26-11-9-16-13-20(25(2)3)19(12-17(16)14-26)15-5-7-18(8-6-15)21(22,23)24/h4-8,12-13H,1,9-11,14H2,2-3H3 |
| InChIKey | DTGCWOMWBUNSGR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|