C17H19N3 — CID 44568534
(6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,11-diamine (PubChem CID 44568534) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is (6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,11-diamine.
| Compound Name | (6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,11-diamine |
|---|---|
| PubChem CID | 44568534 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | (6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,11-diamine |
| SMILES | CN1CCc2cc(N)cc3c2[C@H]1Cc1cccc(N)c1-3 |
| InChI | InChI=1S/C17H19N3/c1-20-6-5-11-7-12(18)9-13-16-10(3-2-4-14(16)19)8-15(20)17(11)13/h2-4,7,9,15H,5-6,8,18-19H2,1H3/t15-/m1/s1 |
| InChIKey | SBZULQRCMCHLCL-OAHLLOKOSA-N |
| XLogP | 2.60 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|