C27H34N2 — CID 44627903
(1R,9R,10R)-17-(cyclobutylmethyl)-N-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine (PubChem CID 44627903) has the molecular formula C27H34N2 and a molecular weight of 386.58 g/mol. Its IUPAC name is (1R,9R,10R)-17-(cyclobutylmethyl)-N-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine.
| Compound Name | (1R,9R,10R)-17-(cyclobutylmethyl)-N-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 44627903 |
| Molecular Formula | C27H34N2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (1R,9R,10R)-17-(cyclobutylmethyl)-N-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
| SMILES | c1ccc(Nc2ccc3c(c2)[C@@]24CCCC[C@H]2[C@@H](C3)N(CC2CCC2)CC4)cc1 |
| InChI | InChI=1S/C27H34N2/c1-2-9-22(10-3-1)28-23-13-12-21-17-26-24-11-4-5-14-27(24,25(21)18-23)15-16-29(26)19-20-7-6-8-20/h1-3,9-10,12-13,18,20,24,26,28H,4-8,11,14-17,19H2/t24-,26+,27+/m0/s1 |
| InChIKey | JXXVPNRGUCGAEU-WYMJOSIYSA-N |
| XLogP | 6.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |