C21H22ClN3OS — CID 156810454
1-(2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)prop-2-en-1-one;1-ethyl-4-phenylpyrazole (PubChem CID 156810454) has the molecular formula C21H22ClN3OS and a molecular weight of 399.95 g/mol. Its IUPAC name is 1-(2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)prop-2-en-1-one;1-ethyl-4-phenylpyrazole.
| Compound Name | 1-(2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)prop-2-en-1-one;1-ethyl-4-phenylpyrazole |
|---|---|
| PubChem CID | 156810454 |
| Molecular Formula | C21H22ClN3OS |
| Molecular Weight | 399.95 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 1-(2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)prop-2-en-1-one;1-ethyl-4-phenylpyrazole |
| SMILES | C=CC(=O)N1CCc2cc(Cl)sc2C1.CCn1cc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C11H12N2.C10H10ClNOS/c1-2-13-9-11(8-12-13)10-6-4-3-5-7-10;1-2-10(13)12-4-3-7-5-9(11)14-8(7)6-12/h3-9H,2H2,1H3;2,5H,1,3-4,6H2 |
| InChIKey | WWKFPDVRKQPZQU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.95 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|