C22H20Cl2N2S — CID 156810509
6-buta-1,3-dien-2-yl-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridine;2-chloro-3-phenylpyridine (PubChem CID 156810509) has the molecular formula C22H20Cl2N2S and a molecular weight of 415.39 g/mol. Its IUPAC name is 6-buta-1,3-dien-2-yl-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridine;2-chloro-3-phenylpyridine.
| Compound Name | 6-buta-1,3-dien-2-yl-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridine;2-chloro-3-phenylpyridine |
|---|---|
| PubChem CID | 156810509 |
| Molecular Formula | C22H20Cl2N2S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 6-buta-1,3-dien-2-yl-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridine;2-chloro-3-phenylpyridine |
| SMILES | C=CC(=C)N1CCc2cc(Cl)sc2C1.Clc1ncccc1-c1ccccc1 |
| InChI | InChI=1S/C11H12ClNS.C11H8ClN/c1-3-8(2)13-5-4-9-6-11(12)14-10(9)7-13;12-11-10(7-4-8-13-11)9-5-2-1-3-6-9/h3,6H,1-2,4-5,7H2;1-8H |
| InChIKey | UNVBVJMIRNUJNW-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|