C21H20Cl2N2S2 — CID 156810308
buta-1,3-diene;2-chloro-4-[2-(2-chloro-3-pyridinyl)thiophen-3-yl]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine (PubChem CID 156810308) has the molecular formula C21H20Cl2N2S2 and a molecular weight of 435.45 g/mol. Its IUPAC name is buta-1,3-diene;2-chloro-4-[2-(2-chloro-3-pyridinyl)thiophen-3-yl]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine.
| Compound Name | buta-1,3-diene;2-chloro-4-[2-(2-chloro-3-pyridinyl)thiophen-3-yl]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 156810308 |
| Molecular Formula | C21H20Cl2N2S2 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | buta-1,3-diene;2-chloro-4-[2-(2-chloro-3-pyridinyl)thiophen-3-yl]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine |
| SMILES | C=CC=C.CN1Cc2sc(Cl)cc2C(c2ccsc2-c2cccnc2Cl)C1 |
| InChI | InChI=1S/C17H14Cl2N2S2.C4H6/c1-21-8-13(12-7-15(18)23-14(12)9-21)10-4-6-22-16(10)11-3-2-5-20-17(11)19;1-3-4-2/h2-7,13H,8-9H2,1H3;3-4H,1-2H2 |
| InChIKey | JYUNVUIETRZNDS-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|