C14H11Cl2NOS2 — CID 156810275
1-[(4S)-2-chloro-4-(2-chlorothiophen-3-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one (PubChem CID 156810275) has the molecular formula C14H11Cl2NOS2 and a molecular weight of 344.29 g/mol. Its IUPAC name is 1-[(4S)-2-chloro-4-(2-chlorothiophen-3-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one.
| Compound Name | 1-[(4S)-2-chloro-4-(2-chlorothiophen-3-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156810275 |
| Molecular Formula | C14H11Cl2NOS2 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | 1-[(4S)-2-chloro-4-(2-chlorothiophen-3-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1Cc2sc(Cl)cc2[C@@H](c2ccsc2Cl)C1 |
| InChI | InChI=1S/C14H11Cl2NOS2/c1-2-13(18)17-6-10(8-3-4-19-14(8)16)9-5-12(15)20-11(9)7-17/h2-5,10H,1,6-7H2/t10-/m1/s1 |
| InChIKey | OQUBFNSNOJKZCC-SNVBAGLBSA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|