C14H11BrClNOS2 — CID 156810283
1-[(4R)-4-(3-bromothiophen-2-yl)-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one (PubChem CID 156810283) has the molecular formula C14H11BrClNOS2 and a molecular weight of 388.74 g/mol. Its IUPAC name is 1-[(4R)-4-(3-bromothiophen-2-yl)-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one.
| Compound Name | 1-[(4R)-4-(3-bromothiophen-2-yl)-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156810283 |
| Molecular Formula | C14H11BrClNOS2 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 386.92 |
| IUPAC Name | 1-[(4R)-4-(3-bromothiophen-2-yl)-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1Cc2sc(Cl)cc2[C@@H](c2sccc2Br)C1 |
| InChI | InChI=1S/C14H11BrClNOS2/c1-2-13(18)17-6-9(14-10(15)3-4-19-14)8-5-12(16)20-11(8)7-17/h2-5,9H,1,6-7H2/t9-/m0/s1 |
| InChIKey | ACPOJXDURBBTPJ-VIFPVBQESA-N |
| XLogP | 4.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|