C14H16ClNO3S — CID 155140664
(2R)-2-[(4R)-2-chloro-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl]butanoic acid (PubChem CID 155140664) has the molecular formula C14H16ClNO3S and a molecular weight of 313.81 g/mol. Its IUPAC name is (2R)-2-[(4R)-2-chloro-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl]butanoic acid.
| Compound Name | (2R)-2-[(4R)-2-chloro-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 155140664 |
| Molecular Formula | C14H16ClNO3S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | (2R)-2-[(4R)-2-chloro-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl]butanoic acid |
| SMILES | C=CC(=O)N1Cc2sc(Cl)cc2[C@@H]([C@@H](CC)C(=O)O)C1 |
| InChI | InChI=1S/C14H16ClNO3S/c1-3-8(14(18)19)10-6-16(13(17)4-2)7-11-9(10)5-12(15)20-11/h4-5,8,10H,2-3,6-7H2,1H3,(H,18,19)/t8-,10-/m1/s1 |
| InChIKey | IKYBTRCHPPNRFA-PSASIEDQSA-N |
| XLogP | 3.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|