C12H20N2O — CID 126491189
(E)-1,4-dipyrrolidin-1-ylbut-2-en-1-one (PubChem CID 126491189) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is (E)-1,4-dipyrrolidin-1-ylbut-2-en-1-one.
| Compound Name | (E)-1,4-dipyrrolidin-1-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 126491189 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (E)-1,4-dipyrrolidin-1-ylbut-2-en-1-one |
| SMILES | O=C(/C=C/CN1CCCC1)N1CCCC1 |
| InChI | InChI=1S/C12H20N2O/c15-12(14-10-3-4-11-14)6-5-9-13-7-1-2-8-13/h5-6H,1-4,7-11H2/b6-5+ |
| InChIKey | ZHGYGMFZGOVCDK-AATRIKPKSA-N |
| XLogP | 1.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|