C28H36N2O3 — CID 159467988
(E)-3-(2-hydroxyphenyl)-1-piperidin-1-ylprop-2-en-1-one;2-[(E)-3-piperidin-1-ylprop-1-enyl]phenol (PubChem CID 159467988) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is (E)-3-(2-hydroxyphenyl)-1-piperidin-1-ylprop-2-en-1-one;2-[(E)-3-piperidin-1-ylprop-1-enyl]phenol.
| Compound Name | (E)-3-(2-hydroxyphenyl)-1-piperidin-1-ylprop-2-en-1-one;2-[(E)-3-piperidin-1-ylprop-1-enyl]phenol |
|---|---|
| PubChem CID | 159467988 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | (E)-3-(2-hydroxyphenyl)-1-piperidin-1-ylprop-2-en-1-one;2-[(E)-3-piperidin-1-ylprop-1-enyl]phenol |
| SMILES | O=C(/C=C/c1ccccc1O)N1CCCCC1.Oc1ccccc1/C=C/CN1CCCCC1 |
| InChI | InChI=1S/C14H17NO2.C14H19NO/c16-13-7-3-2-6-12(13)8-9-14(17)15-10-4-1-5-11-15;16-14-9-3-2-7-13(14)8-6-12-15-10-4-1-5-11-15/h2-3,6-9,16H,1,4-5,10-11H2;2-3,6-9,16H,1,4-5,10-12H2/b9-8+;8-6+ |
| InChIKey | LVKWOYZPOBIQMM-BYMVNGRDSA-N |
| XLogP | 5.31 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|