C12H21NO — CID 146188205
(E)-5-methyl-1-pyrrolidin-1-ylhept-2-en-4-one (PubChem CID 146188205) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (E)-5-methyl-1-pyrrolidin-1-ylhept-2-en-4-one.
| Compound Name | (E)-5-methyl-1-pyrrolidin-1-ylhept-2-en-4-one |
|---|---|
| PubChem CID | 146188205 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (E)-5-methyl-1-pyrrolidin-1-ylhept-2-en-4-one |
| SMILES | CCC(C)C(=O)/C=C/CN1CCCC1 |
| InChI | InChI=1S/C12H21NO/c1-3-11(2)12(14)7-6-10-13-8-4-5-9-13/h6-7,11H,3-5,8-10H2,1-2H3/b7-6+ |
| InChIKey | QXAMYDCQJKBGHO-VOTSOKGWSA-N |
| XLogP | 2.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|