C19H25F2N3O — CID 166318667
(E)-1-[4-(3,4-difluorophenyl)-1,4-diazepan-1-yl]-4-pyrrolidin-1-ylbut-2-en-1-one (PubChem CID 166318667) has the molecular formula C19H25F2N3O and a molecular weight of 349.43 g/mol. Its IUPAC name is (E)-1-[4-(3,4-difluorophenyl)-1,4-diazepan-1-yl]-4-pyrrolidin-1-ylbut-2-en-1-one.
| Compound Name | (E)-1-[4-(3,4-difluorophenyl)-1,4-diazepan-1-yl]-4-pyrrolidin-1-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 166318667 |
| Molecular Formula | C19H25F2N3O |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (E)-1-[4-(3,4-difluorophenyl)-1,4-diazepan-1-yl]-4-pyrrolidin-1-ylbut-2-en-1-one |
| SMILES | O=C(/C=C/CN1CCCC1)N1CCCN(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H25F2N3O/c20-17-7-6-16(15-18(17)21)23-11-4-12-24(14-13-23)19(25)5-3-10-22-8-1-2-9-22/h3,5-7,15H,1-2,4,8-14H2/b5-3+ |
| InChIKey | ILYOOLLTCFWZHC-HWKANZROSA-N |
| XLogP | 2.66 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|