C17H17F2N3O2 — CID 136549310
2-[4-(3,4-difluorophenyl)-1,4-diazepan-1-yl]pyridine-3-carboxylic acid (PubChem CID 136549310) has the molecular formula C17H17F2N3O2 and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-[4-(3,4-difluorophenyl)-1,4-diazepan-1-yl]pyridine-3-carboxylic acid.
| Compound Name | 2-[4-(3,4-difluorophenyl)-1,4-diazepan-1-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 136549310 |
| Molecular Formula | C17H17F2N3O2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-[4-(3,4-difluorophenyl)-1,4-diazepan-1-yl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1N1CCCN(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C17H17F2N3O2/c18-14-5-4-12(11-15(14)19)21-7-2-8-22(10-9-21)16-13(17(23)24)3-1-6-20-16/h1,3-6,11H,2,7-10H2,(H,23,24) |
| InChIKey | IOOOIOUBCCOCQV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |