C10H12N2O2 — CID 2794739
2-pyrrolidin-1-ylpyridine-3-carboxylic acid (PubChem CID 2794739) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylpyridine-3-carboxylic acid.
| Compound Name | 2-pyrrolidin-1-ylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 2794739 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-pyrrolidin-1-ylpyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1N1CCCC1 |
| InChI | InChI=1S/C10H12N2O2/c13-10(14)8-4-3-5-11-9(8)12-6-1-2-7-12/h3-5H,1-2,6-7H2,(H,13,14) |
| InChIKey | DTUSJCJZQJAPGD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |