C17H17N5O2S — CID 172654620
4-[(E)-[(11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)hydrazinylidene]methyl]benzene-1,2-diol (PubChem CID 172654620) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 4-[(E)-[(11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)hydrazinylidene]methyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-[(11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)hydrazinylidene]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 172654620 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-[(E)-[(11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)hydrazinylidene]methyl]benzene-1,2-diol |
| SMILES | CN1CCc2c(sc3ncnc(N/N=C/c4ccc(O)c(O)c4)c23)C1 |
| InChI | InChI=1S/C17H17N5O2S/c1-22-5-4-11-14(8-22)25-17-15(11)16(18-9-19-17)21-20-7-10-2-3-12(23)13(24)6-10/h2-3,6-7,9,23-24H,4-5,8H2,1H3,(H,18,19,21)/b20-7+ |
| InChIKey | OHVINQRCMZWUTK-IFRROFPPSA-N |
| XLogP | 2.54 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|