C28H27N3O2 — CID 4638678
methyl 4-[[4-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]phenyl]diazenyl]benzoate (PubChem CID 4638678) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is methyl 4-[[4-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]phenyl]diazenyl]benzoate.
| Compound Name | methyl 4-[[4-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 4638678 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | methyl 4-[[4-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]phenyl]diazenyl]benzoate |
| SMILES | COC(=O)c1ccc(/N=N/c2ccc(C=CC=C3N(C)c4ccccc4C3(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H27N3O2/c1-28(2)24-9-5-6-10-25(24)31(3)26(28)11-7-8-20-12-16-22(17-13-20)29-30-23-18-14-21(15-19-23)27(32)33-4/h5-19H,1-4H3/b8-7?,26-11?,30-29+ |
| InChIKey | HMPIQQFKRVJAKB-LYUFVSKESA-N |
| XLogP | 7.21 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|