C23H28F3N5O2S — CID 60608761
(1E)-3-[[5-morpholin-4-yl-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one (PubChem CID 60608761) has the molecular formula C23H28F3N5O2S and a molecular weight of 495.57 g/mol. Its IUPAC name is (1E)-3-[[5-morpholin-4-yl-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one.
| Compound Name | (1E)-3-[[5-morpholin-4-yl-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one |
|---|---|
| PubChem CID | 60608761 |
| Molecular Formula | C23H28F3N5O2S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | (1E)-3-[[5-morpholin-4-yl-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one |
| SMILES | CC(Sc1nnc(N2CCOCC2)n1CC(F)(F)F)C(=O)/C=C1/N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C23H28F3N5O2S/c1-15(18(32)13-19-22(2,3)16-7-5-6-8-17(16)29(19)4)34-21-28-27-20(30-9-11-33-12-10-30)31(21)14-23(24,25)26/h5-8,13,15H,9-12,14H2,1-4H3/b19-13+ |
| InChIKey | HIRUKYIQXIZKJB-CPNJWEJPSA-N |
| XLogP | 4.04 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|