C20H24N4OS — CID 93145114
(1Z,3S)-3-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one (PubChem CID 93145114) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is (1Z,3S)-3-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one.
| Compound Name | (1Z,3S)-3-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one |
|---|---|
| PubChem CID | 93145114 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (1Z,3S)-3-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one |
| SMILES | C=CCn1cnnc1S[C@@H](C)C(=O)/C=C1\N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C20H24N4OS/c1-6-11-24-13-21-22-19(24)26-14(2)17(25)12-18-20(3,4)15-9-7-8-10-16(15)23(18)5/h6-10,12-14H,1,11H2,2-5H3/b18-12-/t14-/m0/s1 |
| InChIKey | WYYGFTSILXTWQU-HIXWQLQUSA-N |
| XLogP | 3.83 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|