C25H28N4OS — CID 24577244
(1Z)-3-[(5-benzyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one (PubChem CID 24577244) has the molecular formula C25H28N4OS and a molecular weight of 432.59 g/mol. Its IUPAC name is (1Z)-3-[(5-benzyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one.
| Compound Name | (1Z)-3-[(5-benzyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one |
|---|---|
| PubChem CID | 24577244 |
| Molecular Formula | C25H28N4OS |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (1Z)-3-[(5-benzyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one |
| SMILES | CC(Sc1nnc(Cc2ccccc2)n1C)C(=O)/C=C1\N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C25H28N4OS/c1-17(31-24-27-26-23(29(24)5)15-18-11-7-6-8-12-18)21(30)16-22-25(2,3)19-13-9-10-14-20(19)28(22)4/h6-14,16-17H,15H2,1-5H3/b22-16- |
| InChIKey | NKTIXWSGHOODAT-JWGURIENSA-N |
| XLogP | 4.77 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|