C18H22N4OS — CID 24600548
(1Z)-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one (PubChem CID 24600548) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is (1Z)-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one.
| Compound Name | (1Z)-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one |
|---|---|
| PubChem CID | 24600548 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (1Z)-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one |
| SMILES | Cc1nc(SC(C)C(=O)/C=C2\N(C)c3ccccc3C2(C)C)n[nH]1 |
| InChI | InChI=1S/C18H22N4OS/c1-11(24-17-19-12(2)20-21-17)15(23)10-16-18(3,4)13-8-6-7-9-14(13)22(16)5/h6-11H,1-5H3,(H,19,20,21)/b16-10- |
| InChIKey | NKFWYXMITWTHQD-YBEGLDIGSA-N |
| XLogP | 3.47 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|