C25H36N3O2PS — CID 2314829
[(3E)-3-benzylidene-2-piperidin-1-ylcyclopenten-1-yl]-dimorpholin-4-yl-sulfanylidene-lambda5-phosphane (PubChem CID 2314829) has the molecular formula C25H36N3O2PS and a molecular weight of 473.62 g/mol. Its IUPAC name is [(3E)-3-benzylidene-2-piperidin-1-ylcyclopenten-1-yl]-dimorpholin-4-yl-sulfanylidene-lambda5-phosphane.
| Compound Name | [(3E)-3-benzylidene-2-piperidin-1-ylcyclopenten-1-yl]-dimorpholin-4-yl-sulfanylidene-lambda5-phosphane |
|---|---|
| PubChem CID | 2314829 |
| Molecular Formula | C25H36N3O2PS |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | [(3E)-3-benzylidene-2-piperidin-1-ylcyclopenten-1-yl]-dimorpholin-4-yl-sulfanylidene-lambda5-phosphane |
| SMILES | S=P(C1=C(N2CCCCC2)/C(=C/c2ccccc2)CC1)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C25H36N3O2PS/c32-31(27-13-17-29-18-14-27,28-15-19-30-20-16-28)24-10-9-23(21-22-7-3-1-4-8-22)25(24)26-11-5-2-6-12-26/h1,3-4,7-8,21H,2,5-6,9-20H2/b23-21+ |
| InChIKey | ZCSZNQAZEQNWDP-XTQSDGFTSA-N |
| XLogP | 4.54 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|