C34H38N4O — CID 84583005
N-(4-benzhydrylpiperazin-1-yl)-1-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methanimine (PubChem CID 84583005) has the molecular formula C34H38N4O and a molecular weight of 518.71 g/mol. Its IUPAC name is N-(4-benzhydrylpiperazin-1-yl)-1-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methanimine.
| Compound Name | N-(4-benzhydrylpiperazin-1-yl)-1-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methanimine |
|---|---|
| PubChem CID | 84583005 |
| Molecular Formula | C34H38N4O |
| Molecular Weight | 518.71 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | N-(4-benzhydrylpiperazin-1-yl)-1-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methanimine |
| SMILES | C(=NN1CCN(C(c2ccccc2)c2ccccc2)CC1)C1=C(N2CCOCC2)/C(=C\c2ccccc2)CC1 |
| InChI | InChI=1S/C34H38N4O/c1-4-10-28(11-5-1)26-31-16-17-32(34(31)37-22-24-39-25-23-37)27-35-38-20-18-36(19-21-38)33(29-12-6-2-7-13-29)30-14-8-3-9-15-30/h1-15,26-27,33H,16-25H2/b31-26-,35-27? |
| InChIKey | MKEZJGOLZRLQFL-YYUYQLJMSA-N |
| XLogP | 5.84 |
| TPSA | 31.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.71 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|