C24H26N4O3 — CID 8883664
N-[(Z)-(3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl)methylideneamino]-2-(2-oxo-1-pyridinyl)acetamide (PubChem CID 8883664) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[(Z)-(3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl)methylideneamino]-2-(2-oxo-1-pyridinyl)acetamide.
| Compound Name | N-[(Z)-(3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl)methylideneamino]-2-(2-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 8883664 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-[(Z)-(3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl)methylideneamino]-2-(2-oxo-1-pyridinyl)acetamide |
| SMILES | O=C(Cn1ccccc1=O)N/N=C\C1=C(N2CCOCC2)C(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N4O3/c29-22(18-28-11-5-4-8-23(28)30)26-25-17-21-10-9-20(16-19-6-2-1-3-7-19)24(21)27-12-14-31-15-13-27/h1-8,11,16-17H,9-10,12-15,18H2,(H,26,29)/b20-16?,25-17- |
| InChIKey | XQOVFDXNHWCZPB-MZSFRFJDSA-N |
| XLogP | 2.41 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|