C22H30N6 — CID 4679735
N-[(3-methylphenyl)methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine (PubChem CID 4679735) has the molecular formula C22H30N6 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[(3-methylphenyl)methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine.
| Compound Name | N-[(3-methylphenyl)methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 4679735 |
| Molecular Formula | C22H30N6 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | N-[(3-methylphenyl)methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine |
| SMILES | Cc1cccc(C=NNc2cc(N3CCCCC3)nc(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C22H30N6/c1-18-9-8-10-19(15-18)17-23-26-20-16-21(27-11-4-2-5-12-27)25-22(24-20)28-13-6-3-7-14-28/h8-10,15-17H,2-7,11-14H2,1H3,(H,24,25,26) |
| InChIKey | LCGZXVBJSNULGU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|