C22H29N5O2 — CID 143341240
ethyl 3-[4-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-piperidin-1-ylpyrimidin-2-yl]propanoate (PubChem CID 143341240) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is ethyl 3-[4-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-piperidin-1-ylpyrimidin-2-yl]propanoate.
| Compound Name | ethyl 3-[4-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-piperidin-1-ylpyrimidin-2-yl]propanoate |
|---|---|
| PubChem CID | 143341240 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | ethyl 3-[4-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-piperidin-1-ylpyrimidin-2-yl]propanoate |
| SMILES | CCOC(=O)CCc1nc(N/N=C/c2cccc(C)c2)cc(N2CCCCC2)n1 |
| InChI | InChI=1S/C22H29N5O2/c1-3-29-22(28)11-10-19-24-20(15-21(25-19)27-12-5-4-6-13-27)26-23-16-18-9-7-8-17(2)14-18/h7-9,14-16H,3-6,10-13H2,1-2H3,(H,24,25,26)/b23-16+ |
| InChIKey | DKCACTWQBFRRKH-XQNSMLJCSA-N |
| XLogP | 3.72 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|