C23H30N6O5 — CID 58613205
2-[4-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl morpholine-4-carboxylate (PubChem CID 58613205) has the molecular formula C23H30N6O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[4-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl morpholine-4-carboxylate.
| Compound Name | 2-[4-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl morpholine-4-carboxylate |
|---|---|
| PubChem CID | 58613205 |
| Molecular Formula | C23H30N6O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 2-[4-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl morpholine-4-carboxylate |
| SMILES | Cc1cccc(/C=N/Nc2cc(N3CCOCC3)nc(OCCOC(=O)N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C23H30N6O5/c1-18-3-2-4-19(15-18)17-24-27-20-16-21(28-5-9-31-10-6-28)26-22(25-20)33-13-14-34-23(30)29-7-11-32-12-8-29/h2-4,15-17H,5-14H2,1H3,(H,25,26,27)/b24-17+ |
| InChIKey | LLTXTDSEVVXFTI-JJIBRWJFSA-N |
| XLogP | 1.92 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|