C21H27N5O3 — CID 150980685
3-[4-[2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-yl-2-pyridinyl]propyl carbamate (PubChem CID 150980685) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-[4-[2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-yl-2-pyridinyl]propyl carbamate.
| Compound Name | 3-[4-[2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-yl-2-pyridinyl]propyl carbamate |
|---|---|
| PubChem CID | 150980685 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 3-[4-[2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-yl-2-pyridinyl]propyl carbamate |
| SMILES | Cc1cccc(C=NNc2cc(CCCOC(N)=O)nc(N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C21H27N5O3/c1-16-4-2-5-17(12-16)15-23-25-19-13-18(6-3-9-29-21(22)27)24-20(14-19)26-7-10-28-11-8-26/h2,4-5,12-15H,3,6-11H2,1H3,(H2,22,27)(H,24,25) |
| InChIKey | LQAKGFQNABODPK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|