C26H27F3N6O3 — CID 11713445
2-[4-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]ethyl N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 11713445) has the molecular formula C26H27F3N6O3 and a molecular weight of 528.54 g/mol. Its IUPAC name is 2-[4-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]ethyl N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | 2-[4-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]ethyl N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 11713445 |
| Molecular Formula | C26H27F3N6O3 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 2-[4-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]ethyl N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | Cc1cccc(/C=N/Nc2cc(N3CCOCC3)nc(CCOC(=O)Nc3cccc(C(F)(F)F)c3)n2)c1 |
| InChI | InChI=1S/C26H27F3N6O3/c1-18-4-2-5-19(14-18)17-30-34-23-16-24(35-9-12-37-13-10-35)33-22(32-23)8-11-38-25(36)31-21-7-3-6-20(15-21)26(27,28)29/h2-7,14-17H,8-13H2,1H3,(H,31,36)(H,32,33,34)/b30-17+ |
| InChIKey | IEGMOQRYPUQTHL-OCSSWDANSA-N |
| XLogP | 4.88 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|