C23H32N6O2 — CID 11453023
2-N-[(E)-(3-methylphenyl)methylideneamino]-6-morpholin-4-yl-4-N-(2-morpholin-4-ylethyl)pyridine-2,4-diamine (PubChem CID 11453023) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-N-[(E)-(3-methylphenyl)methylideneamino]-6-morpholin-4-yl-4-N-(2-morpholin-4-ylethyl)pyridine-2,4-diamine.
| Compound Name | 2-N-[(E)-(3-methylphenyl)methylideneamino]-6-morpholin-4-yl-4-N-(2-morpholin-4-ylethyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 11453023 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 2-N-[(E)-(3-methylphenyl)methylideneamino]-6-morpholin-4-yl-4-N-(2-morpholin-4-ylethyl)pyridine-2,4-diamine |
| SMILES | Cc1cccc(/C=N/Nc2cc(NCCN3CCOCC3)cc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C23H32N6O2/c1-19-3-2-4-20(15-19)18-25-27-22-16-21(24-5-6-28-7-11-30-12-8-28)17-23(26-22)29-9-13-31-14-10-29/h2-4,15-18H,5-14H2,1H3,(H2,24,26,27)/b25-18+ |
| InChIKey | VOSNALKKMGDXQD-XIEYBQDHSA-N |
| XLogP | 2.42 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|