C27H42N6O — CID 89358423
6-N-ethyl-2-N-[(E)-(3-methylphenyl)methylideneamino]-6-N-(2-morpholin-4-ylethyl)-4-N,4-N-dipropylpyridine-2,4,6-triamine (PubChem CID 89358423) has the molecular formula C27H42N6O and a molecular weight of 466.67 g/mol. Its IUPAC name is 6-N-ethyl-2-N-[(E)-(3-methylphenyl)methylideneamino]-6-N-(2-morpholin-4-ylethyl)-4-N,4-N-dipropylpyridine-2,4,6-triamine.
| Compound Name | 6-N-ethyl-2-N-[(E)-(3-methylphenyl)methylideneamino]-6-N-(2-morpholin-4-ylethyl)-4-N,4-N-dipropylpyridine-2,4,6-triamine |
|---|---|
| PubChem CID | 89358423 |
| Molecular Formula | C27H42N6O |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | 6-N-ethyl-2-N-[(E)-(3-methylphenyl)methylideneamino]-6-N-(2-morpholin-4-ylethyl)-4-N,4-N-dipropylpyridine-2,4,6-triamine |
| SMILES | CCCN(CCC)c1cc(N/N=C/c2cccc(C)c2)nc(N(CC)CCN2CCOCC2)c1 |
| InChI | InChI=1S/C27H42N6O/c1-5-11-33(12-6-2)25-20-26(30-28-22-24-10-8-9-23(4)19-24)29-27(21-25)32(7-3)14-13-31-15-17-34-18-16-31/h8-10,19-22H,5-7,11-18H2,1-4H3,(H,29,30)/b28-22+ |
| InChIKey | SFMJGURJWMZVFD-XAYXJRQQSA-N |
| XLogP | 4.62 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|