C23H33N5O2 — CID 66682112
6-[2-(diethylamino)ethoxy]-N-[(3-methylphenyl)methylideneamino]-4-morpholin-4-ylpyridin-2-amine (PubChem CID 66682112) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 6-[2-(diethylamino)ethoxy]-N-[(3-methylphenyl)methylideneamino]-4-morpholin-4-ylpyridin-2-amine.
| Compound Name | 6-[2-(diethylamino)ethoxy]-N-[(3-methylphenyl)methylideneamino]-4-morpholin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 66682112 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 6-[2-(diethylamino)ethoxy]-N-[(3-methylphenyl)methylideneamino]-4-morpholin-4-ylpyridin-2-amine |
| SMILES | CCN(CC)CCOc1cc(N2CCOCC2)cc(NN=Cc2cccc(C)c2)n1 |
| InChI | InChI=1S/C23H33N5O2/c1-4-27(5-2)9-14-30-23-17-21(28-10-12-29-13-11-28)16-22(25-23)26-24-18-20-8-6-7-19(3)15-20/h6-8,15-18H,4-5,9-14H2,1-3H3,(H,25,26) |
| InChIKey | XPQQUKCWIQMLEO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|