C24H31N5O5 — CID 11431329
2-[[6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-2-pyridinyl]oxy]ethyl morpholine-4-carboxylate (PubChem CID 11431329) has the molecular formula C24H31N5O5 and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-[[6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-2-pyridinyl]oxy]ethyl morpholine-4-carboxylate.
| Compound Name | 2-[[6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-2-pyridinyl]oxy]ethyl morpholine-4-carboxylate |
|---|---|
| PubChem CID | 11431329 |
| Molecular Formula | C24H31N5O5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 2-[[6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-4-morpholin-4-yl-2-pyridinyl]oxy]ethyl morpholine-4-carboxylate |
| SMILES | Cc1cccc(/C=N/Nc2cc(N3CCOCC3)cc(OCCOC(=O)N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C24H31N5O5/c1-19-3-2-4-20(15-19)18-25-27-22-16-21(28-5-9-31-10-6-28)17-23(26-22)33-13-14-34-24(30)29-7-11-32-12-8-29/h2-4,15-18H,5-14H2,1H3,(H,26,27)/b25-18+ |
| InChIKey | KTWUMOBBHFFOGV-XIEYBQDHSA-N |
| XLogP | 2.52 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|