C28H35N5O3 — CID 89332304
2-[[4-(dipropylamino)-6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-2-pyridinyl]oxy]ethyl N-phenylcarbamate (PubChem CID 89332304) has the molecular formula C28H35N5O3 and a molecular weight of 489.62 g/mol. Its IUPAC name is 2-[[4-(dipropylamino)-6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-2-pyridinyl]oxy]ethyl N-phenylcarbamate.
| Compound Name | 2-[[4-(dipropylamino)-6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-2-pyridinyl]oxy]ethyl N-phenylcarbamate |
|---|---|
| PubChem CID | 89332304 |
| Molecular Formula | C28H35N5O3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 2-[[4-(dipropylamino)-6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-2-pyridinyl]oxy]ethyl N-phenylcarbamate |
| SMILES | CCCN(CCC)c1cc(N/N=C/c2cccc(C)c2)nc(OCCOC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C28H35N5O3/c1-4-14-33(15-5-2)25-19-26(32-29-21-23-11-9-10-22(3)18-23)31-27(20-25)35-16-17-36-28(34)30-24-12-7-6-8-13-24/h6-13,18-21H,4-5,14-17H2,1-3H3,(H,30,34)(H,31,32)/b29-21+ |
| InChIKey | HXPQFJVIMXYPGC-XHLNEMQHSA-N |
| XLogP | 6.09 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|